CAS 1249139-53-4 appears in our catalog under these names: 6-Fluoro-4-methoxy-1,3-benzothiazol-2-amine, 6-Fluoro-4-methoxy-1,3-benzothiazol-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
6-fluoro-4-methoxy-1,3-benzothiazol-2-amine (CAS 1249139-53-4) is a chemical compound with the molecular formula C8H7FN2OS and a molecular weight of 198.22 g/mol. IUPAC name: 6-fluoro-4-methoxy-1,3-benzothiazol-2-amine. InChIKey: PMQKEBRMDRHQRX-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2OS |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 6-fluoro-4-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | PMQKEBRMDRHQRX-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)F)SC(=N2)N |
Computed by PubChem (NCBI)