CAS 134057-48-0 is the registry number for 2-Benzothiazolamine,5-fluoro-6-methoxy-(9CI), >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-fluoro-6-methoxy-1,3-benzothiazol-2-amine (CAS 134057-48-0) is a chemical compound with the molecular formula C8H7FN2OS and a molecular weight of 198.22 g/mol. IUPAC name: 5-fluoro-6-methoxy-1,3-benzothiazol-2-amine. InChIKey: OIJIAORDLXFVKC-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2OS |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5-fluoro-6-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | OIJIAORDLXFVKC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)SC(=N2)N)F |
Computed by PubChem (NCBI)