CAS 1344684-78-1 appears in our catalog under these names: 6-Fluoro-5-methoxy-1,3-benzothiazol-2-amine, 95%, 6-Fluoro-5-methoxybenzo[d]thiazol-2-amine 97%, 6-Fluoro-5-methoxy-1,3-benzothiazol-2-amine, 98%, 98%, 2-AMINO-6-FLUORO-5-METHOXYBENZOTHIAZOLE, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
6-fluoro-5-methoxy-1,3-benzothiazol-2-amine (CAS 1344684-78-1) is a chemical compound with the molecular formula C8H7FN2OS and a molecular weight of 198.22 g/mol. IUPAC name: 6-fluoro-5-methoxy-1,3-benzothiazol-2-amine. InChIKey: GWFUCUXXHYVFKV-UHFFFAOYSA-N.
| Molecular formula | C8H7FN2OS |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 6-fluoro-5-methoxy-1,3-benzothiazol-2-amine |
| InChIKey | GWFUCUXXHYVFKV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)N=C(S2)N)F |
Computed by PubChem (NCBI)