CAS 1249240-92-3 appears in our catalog under these names: 2-Cyclopropyl-5-methyloxazole-4-carboxylic acid, 95+%, 2-Cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 1249240-92-3) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: MCIWPTRDTKMNDP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2-cyclopropyl-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | MCIWPTRDTKMNDP-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2CC2)C(=O)O |
Computed by PubChem (NCBI)