CAS 1249267-24-0 appears in our catalog under these names: 2-Methyl-5-(1,3-oxazol-2-yl)aniline, 96%, 2-Methyl-5-(1,3-oxazol-2-yl)aniline, 2-Methyl-5-(1,3-oxazol-2-yl)aniline, 96%, 96%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 5g, 0,5g, 100mg, 250mg, 500mg, 1g, 2.5g.
2-methyl-5-(1,3-oxazol-2-yl)aniline (CAS 1249267-24-0) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2-methyl-5-(1,3-oxazol-2-yl)aniline. InChIKey: CICYPUCSKRAKDJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-methyl-5-(1,3-oxazol-2-yl)aniline |
| InChIKey | CICYPUCSKRAKDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NC=CO2)N |
Computed by PubChem (NCBI)