Products 1249359-99-6
CAS 1249359-99-6 appears in our catalog under these names: 4-Bromo-2-(prop-2-yn-1-yloxy)benzoic acid, 4-Bromo-2-(prop-2-yn-1-yloxy)benzoic acid, 96%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-bromo-2-prop-2-ynoxybenzoic acid (CAS 1249359-99-6) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: 4-bromo-2-prop-2-ynoxybenzoic acid. InChIKey: QSNVVLSQGYCZDT-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | 4-bromo-2-prop-2-ynoxybenzoic acid |
| InChIKey | QSNVVLSQGYCZDT-UHFFFAOYSA-N |
| SMILES | C#CCOC1=C(C=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)