CAS 1249409-41-3 appears in our catalog under these names: (1-(2,3-Dichlorophenyl)-1H-1,2,3-triazol-4-yl)methanol, 95%, (1-(2,3-Dichlorophenyl)-1H-1,2,3-triazol-4-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
[1-(2,3-dichlorophenyl)triazol-4-yl]methanol (CAS 1249409-41-3) is a chemical compound with the molecular formula C9H7Cl2N3O and a molecular weight of 244.07 g/mol. IUPAC name: [1-(2,3-dichlorophenyl)triazol-4-yl]methanol. InChIKey: XECGMHCWQZHPNZ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | [1-(2,3-dichlorophenyl)triazol-4-yl]methanol |
| InChIKey | XECGMHCWQZHPNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)N2C=C(N=N2)CO |
Computed by PubChem (NCBI)