Products 2925243-58-7
CAS 2925243-58-7 is the registry number for 5,7-Dichloro-2,3-dimethylpyrido[2,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2,3-dimethylpyrido[2,3-d]pyrimidin-4-one (CAS 2925243-58-7) is a chemical compound with the molecular formula C9H7Cl2N3O and a molecular weight of 244.07 g/mol. IUPAC name: 5,7-dichloro-2,3-dimethylpyrido[2,3-d]pyrimidin-4-one. InChIKey: TWWGUROQBWUZCH-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 5,7-dichloro-2,3-dimethylpyrido[2,3-d]pyrimidin-4-one |
| InChIKey | TWWGUROQBWUZCH-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC(=N2)Cl)Cl)C(=O)N1C |
Computed by PubChem (NCBI)