Products 1538003-30-3
CAS 1538003-30-3 is the registry number for (2-(3,5-Dichloropyridin-2-yl)-1H-imidazol-5-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(3,5-dichloro-2-pyridinyl)-1H-imidazol-5-yl]methanol (CAS 1538003-30-3) is a chemical compound with the molecular formula C9H7Cl2N3O and a molecular weight of 244.07 g/mol. IUPAC name: [2-(3,5-dichloro-2-pyridinyl)-1H-imidazol-5-yl]methanol. InChIKey: CKEGLLKIYZCBBJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3O |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | [2-(3,5-dichloro-2-pyridinyl)-1H-imidazol-5-yl]methanol |
| InChIKey | CKEGLLKIYZCBBJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C2=NC=C(N2)CO)Cl |
Computed by PubChem (NCBI)