Products 1249456-66-3
CAS 1249456-66-3 appears in our catalog under these names: 2-Chloro-2-(2-chloro-6-fluorophenyl)acetonitrile, 95%, 2-Chloro-2-(2-chloro-6-fluorophenyl)acetonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-chloro-2-(2-chloro-6-fluorophenyl)acetonitrile (CAS 1249456-66-3) is a chemical compound with the molecular formula C8H4Cl2FN and a molecular weight of 204.02 g/mol. IUPAC name: 2-chloro-2-(2-chloro-6-fluorophenyl)acetonitrile. InChIKey: FSOVTOZIYHZIDE-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 2-chloro-2-(2-chloro-6-fluorophenyl)acetonitrile |
| InChIKey | FSOVTOZIYHZIDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C#N)Cl)F |
Computed by PubChem (NCBI)