Products 1804421-31-5
CAS 1804421-31-5 is the registry number for 3,5-Dichloro-4-fluorophenylacetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,5-dichloro-4-fluorophenyl)acetonitrile (CAS 1804421-31-5) is a chemical compound with the molecular formula C8H4Cl2FN and a molecular weight of 204.02 g/mol. IUPAC name: 2-(3,5-dichloro-4-fluorophenyl)acetonitrile. InChIKey: SIQBGJFVRSLZKZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 2-(3,5-dichloro-4-fluorophenyl)acetonitrile |
| InChIKey | SIQBGJFVRSLZKZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)F)Cl)CC#N |
Computed by PubChem (NCBI)