Products 948581-73-5

CAS 948581-73-5 is the registry number for 5,7-Dichloro-4-fluoro-1H-indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5,7-dichloro-4-fluoro-1H-indole (CAS 948581-73-5) is a chemical compound with the molecular formula C8H4Cl2FN and a molecular weight of 204.02 g/mol. IUPAC name: 5,7-dichloro-4-fluoro-1H-indole. InChIKey: NYYCGIXVBYCNGH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2FN
Molecular weight204.02 g/mol
IUPAC name5,7-dichloro-4-fluoro-1H-indole
InChIKeyNYYCGIXVBYCNGH-UHFFFAOYSA-N
SMILESC1=CNC2=C1C(=C(C=C2Cl)Cl)F

Computed by PubChem (NCBI)