CAS 948581-73-5 is the registry number for 5,7-Dichloro-4-fluoro-1H-indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g.
5,7-dichloro-4-fluoro-1H-indole (CAS 948581-73-5) is a chemical compound with the molecular formula C8H4Cl2FN and a molecular weight of 204.02 g/mol. IUPAC name: 5,7-dichloro-4-fluoro-1H-indole. InChIKey: NYYCGIXVBYCNGH-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN |
|---|---|
| Molecular weight | 204.02 g/mol |
| IUPAC name | 5,7-dichloro-4-fluoro-1H-indole |
| InChIKey | NYYCGIXVBYCNGH-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=C(C=C2Cl)Cl)F |
Computed by PubChem (NCBI)