Products 1249563-59-4
CAS 1249563-59-4 is the registry number for 1,2-Dimethyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1,2-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-carboxylic acid (CAS 1249563-59-4) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 1,2-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-carboxylic acid. InChIKey: VKXLCBOIMMOFDA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1,2-dimethyl-3-oxo-2,4-dihydroquinoxaline-6-carboxylic acid |
| InChIKey | VKXLCBOIMMOFDA-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(N1C)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)