Products 1249612-44-9
CAS 1249612-44-9 is the registry number for 2-(3-Chlorophenyl)-2H,3H,3aH,4H,5H,6H-cyclopenta(C)pyrazol-3-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-chlorophenyl)-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one (CAS 1249612-44-9) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 2-(3-chlorophenyl)-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one. InChIKey: ZHJFENNMPNDNBM-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-3a,4,5,6-tetrahydrocyclopenta[c]pyrazol-3-one |
| InChIKey | ZHJFENNMPNDNBM-UHFFFAOYSA-N |
| SMILES | C1CC2C(=NN(C2=O)C3=CC(=CC=C3)Cl)C1 |
Computed by PubChem (NCBI)