Products 1249663-09-9

CAS 1249663-09-9 is the registry number for 5-(tert-Butylthio)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-tert-butylsulfanylfuran-2-carboxylic acid (CAS 1249663-09-9) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: 5-tert-butylsulfanylfuran-2-carboxylic acid. InChIKey: VZYFMGUBEFDRKH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O3S
Molecular weight200.26 g/mol
IUPAC name5-tert-butylsulfanylfuran-2-carboxylic acid
InChIKeyVZYFMGUBEFDRKH-UHFFFAOYSA-N
SMILESCC(C)(C)SC1=CC=C(O1)C(=O)O

Computed by PubChem (NCBI)