CAS 1249871-03-1 appears in our catalog under these names: (4-Chloro-3-fluorophenyl)urea, 95%, (4-Chloro-3-fluorophenyl)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(4-chloro-3-fluorophenyl)urea (CAS 1249871-03-1) is a chemical compound with the molecular formula C7H6ClFN2O and a molecular weight of 188.59 g/mol. IUPAC name: (4-chloro-3-fluorophenyl)urea. InChIKey: CMFJFSVJQNUMGG-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFN2O |
|---|---|
| Molecular weight | 188.59 g/mol |
| IUPAC name | (4-chloro-3-fluorophenyl)urea |
| InChIKey | CMFJFSVJQNUMGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)N)F)Cl |
Computed by PubChem (NCBI)