CAS 1249946-63-1 appears in our catalog under these names: (2-(3,4-Dichlorophenoxy)propyl)(methyl)amine, 95%, (2-(3,4-Dichlorophenoxy)propyl)(methyl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(3,4-dichlorophenoxy)-N-methylpropan-1-amine (CAS 1249946-63-1) is a chemical compound with the molecular formula C10H13Cl2NO and a molecular weight of 234.12 g/mol. IUPAC name: 2-(3,4-dichlorophenoxy)-N-methylpropan-1-amine. InChIKey: HZZCMGXRZAPIFB-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)-N-methylpropan-1-amine |
| InChIKey | HZZCMGXRZAPIFB-UHFFFAOYSA-N |
| SMILES | CC(CNC)OC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)