Products 1250352-89-6

CAS 1250352-89-6 is the registry number for 3-Bromo-2-propoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-2-propoxybenzoic acid (CAS 1250352-89-6) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-2-propoxybenzoic acid. InChIKey: VPFMTDWWNQCBTF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO3
Molecular weight259.10 g/mol
IUPAC name3-bromo-2-propoxybenzoic acid
InChIKeyVPFMTDWWNQCBTF-UHFFFAOYSA-N
SMILESCCCOC1=C(C=CC=C1Br)C(=O)O

Computed by PubChem (NCBI)