Products 1250353-98-0
CAS 1250353-98-0 is the registry number for 5-Amino-N,2-dimethyl-N-(propan-2-yl)benzamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-amino-N,2-dimethyl-N-propan-2-ylbenzamide (CAS 1250353-98-0) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: 5-amino-N,2-dimethyl-N-propan-2-ylbenzamide. InChIKey: IBVOTNSNBHZFLB-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 5-amino-N,2-dimethyl-N-propan-2-ylbenzamide |
| InChIKey | IBVOTNSNBHZFLB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)C(=O)N(C)C(C)C |
Computed by PubChem (NCBI)