CAS 1250379-75-9 is the registry number for 4-Bromo-3-(3,4-dimethylphenyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-5-(3,4-dimethylphenyl)-1H-pyrazole (CAS 1250379-75-9) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 4-bromo-5-(3,4-dimethylphenyl)-1H-pyrazole. InChIKey: JLFDEEFLXIXBIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 4-bromo-5-(3,4-dimethylphenyl)-1H-pyrazole |
| InChIKey | JLFDEEFLXIXBIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=C(C=NN2)Br)C |
Computed by PubChem (NCBI)