CAS 125040-56-4 is the registry number for 2-(Bromomethyl)-5-methylimidazo(1,2-a)pyridine hydrobromide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(bromomethyl)-5-methylimidazo[1,2-a]pyridine;hydrobromide (CAS 125040-56-4) is a chemical compound with the molecular formula C9H10Br2N2 and a molecular weight of 306.00 g/mol. IUPAC name: 2-(bromomethyl)-5-methylimidazo[1,2-a]pyridine;hydrobromide. InChIKey: OUCMQQGQMAVCRQ-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2N2 |
|---|---|
| Molecular weight | 306.00 g/mol |
| IUPAC name | 2-(bromomethyl)-5-methylimidazo[1,2-a]pyridine;hydrobromide |
| InChIKey | OUCMQQGQMAVCRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=NC(=CN12)CBr.Br |
Computed by PubChem (NCBI)