CAS 90326-34-4 is the registry number for 1-(2-Bromoethyl)-1h-benzimidazole hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2-bromoethyl)benzimidazole;hydrobromide (CAS 90326-34-4) is a chemical compound with the molecular formula C9H10Br2N2 and a molecular weight of 306.00 g/mol. IUPAC name: 1-(2-bromoethyl)benzimidazole;hydrobromide. InChIKey: YBRCRDCVJYNGLL-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2N2 |
|---|---|
| Molecular weight | 306.00 g/mol |
| IUPAC name | 1-(2-bromoethyl)benzimidazole;hydrobromide |
| InChIKey | YBRCRDCVJYNGLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2CCBr.Br |
Computed by PubChem (NCBI)