CAS 313048-95-2 is the registry number for 2-(Bromomethyl)-8-methylimidazo(1,2-a)pyridine hydrobromide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(bromomethyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide (CAS 313048-95-2) is a chemical compound with the molecular formula C9H10Br2N2 and a molecular weight of 306.00 g/mol. IUPAC name: 2-(bromomethyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide. InChIKey: OQYIZFXCWRXVRM-UHFFFAOYSA-N.
| Molecular formula | C9H10Br2N2 |
|---|---|
| Molecular weight | 306.00 g/mol |
| IUPAC name | 2-(bromomethyl)-8-methylimidazo[1,2-a]pyridine;hydrobromide |
| InChIKey | OQYIZFXCWRXVRM-UHFFFAOYSA-N |
| SMILES | CC1=CC=CN2C1=NC(=C2)CBr.Br |
Computed by PubChem (NCBI)