Products 1250791-52-6
CAS 1250791-52-6 is the registry number for 4-(Methylsulfonyl)morpholine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methylsulfonylmorpholine-2-carboxylic acid (CAS 1250791-52-6) is a chemical compound with the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. IUPAC name: 4-methylsulfonylmorpholine-2-carboxylic acid. InChIKey: CYFDVACLVSCARX-UHFFFAOYSA-N.
| Molecular formula | C6H11NO5S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 4-methylsulfonylmorpholine-2-carboxylic acid |
| InChIKey | CYFDVACLVSCARX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCOC(C1)C(=O)O |
Computed by PubChem (NCBI)