Products 2172064-76-3
CAS 2172064-76-3 is the registry number for Methyl 3-(sulfamoylmethyl)oxetane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(sulfamoylmethyl)oxetane-3-carboxylate (CAS 2172064-76-3) is a chemical compound with the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. IUPAC name: methyl 3-(sulfamoylmethyl)oxetane-3-carboxylate. InChIKey: SBGNRRJNMWFDTP-UHFFFAOYSA-N.
| Molecular formula | C6H11NO5S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | methyl 3-(sulfamoylmethyl)oxetane-3-carboxylate |
| InChIKey | SBGNRRJNMWFDTP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(COC1)CS(=O)(=O)N |
Computed by PubChem (NCBI)