CAS 716358-43-9 appears in our catalog under these names: 2-(Methanesulfonylcarbamoyl)-2,2-dimethylacetic acid, 95%, 2-(Methanesulfonylcarbamoyl)-2,2-dimethylacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(methanesulfonamido)-2,2-dimethyl-3-oxopropanoic acid (CAS 716358-43-9) is a chemical compound with the molecular formula C6H11NO5S and a molecular weight of 209.22 g/mol. IUPAC name: 3-(methanesulfonamido)-2,2-dimethyl-3-oxopropanoic acid. InChIKey: WPIAEZRNTFAHSA-UHFFFAOYSA-N.
| Molecular formula | C6H11NO5S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 3-(methanesulfonamido)-2,2-dimethyl-3-oxopropanoic acid |
| InChIKey | WPIAEZRNTFAHSA-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)