CAS 1250918-47-8 is the registry number for 4-Methyl-1-[1-(3-thienyl)ethyl]-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-methyl-1-(1-thiophen-3-ylethyl)pyrazol-5-amine (CAS 1250918-47-8) is a chemical compound with the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. IUPAC name: 4-methyl-1-(1-thiophen-3-ylethyl)pyrazol-5-amine. InChIKey: NWIDZNXGFKMKLF-UHFFFAOYSA-N.
| Molecular formula | C10H13N3S |
|---|---|
| Molecular weight | 207.30 g/mol |
| IUPAC name | 4-methyl-1-(1-thiophen-3-ylethyl)pyrazol-5-amine |
| InChIKey | NWIDZNXGFKMKLF-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)C(C)C2=CSC=C2)N |
Computed by PubChem (NCBI)