CAS 1661847-00-2 is the registry number for 3-[(1E)-(Dimethylamino)methylidene]-1-phenylthiourea, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1E)-1-(dimethylaminomethylidene)-3-phenylthiourea (CAS 1661847-00-2) is a chemical compound with the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. IUPAC name: (1E)-1-(dimethylaminomethylidene)-3-phenylthiourea. InChIKey: YVOIYVCUBYCEKA-DHZHZOJOSA-N.
| Molecular formula | C10H13N3S |
|---|---|
| Molecular weight | 207.30 g/mol |
| IUPAC name | (1E)-1-(dimethylaminomethylidene)-3-phenylthiourea |
| InChIKey | YVOIYVCUBYCEKA-DHZHZOJOSA-N |
| SMILES | CN(C)/C=N/C(=S)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)