Products 39263-68-8
CAS 39263-68-8 is the registry number for 5,5-Dimethyl-2-phenyl-1,2,4-triazolane-3-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5,5-dimethyl-2-phenyl-1,2,4-triazolidine-3-thione (CAS 39263-68-8) is a chemical compound with the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. IUPAC name: 5,5-dimethyl-2-phenyl-1,2,4-triazolidine-3-thione. InChIKey: IEGNHJAOYPHKHE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3S |
|---|---|
| Molecular weight | 207.30 g/mol |
| IUPAC name | 5,5-dimethyl-2-phenyl-1,2,4-triazolidine-3-thione |
| InChIKey | IEGNHJAOYPHKHE-UHFFFAOYSA-N |
| SMILES | CC1(NC(=S)N(N1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)