CAS 1251002-05-7 appears in our catalog under these names: 2-(tert-Butoxycarbonyl)-6-oxa-2-azaspiro(3.4)octane-7-carboxylic acid, 98%, 2-((tert-Butoxy)carbonyl)-6-oxa-2-azaspiro(3.4)octane-7-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxa-2-azaspiro[3.4]octane-7-carboxylic acid (CAS 1251002-05-7) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxa-2-azaspiro[3.4]octane-7-carboxylic acid. InChIKey: LXNKMJQJZJKKRR-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxa-2-azaspiro[3.4]octane-7-carboxylic acid |
| InChIKey | LXNKMJQJZJKKRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(OC2)C(=O)O |
Computed by PubChem (NCBI)