Products 1950440-24-0
CAS 1950440-24-0 is the registry number for (2Z)-2-[(2,5-Dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2Z)-2-[(2,5-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (CAS 1950440-24-0) is a chemical compound with the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. IUPAC name: (2Z)-2-[(2,5-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one. InChIKey: DCDDXBMYLSHGGN-UVTDQMKNSA-N.
| Molecular formula | C16H19NO3 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (2Z)-2-[(2,5-dimethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| InChIKey | DCDDXBMYLSHGGN-UVTDQMKNSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)/C=C\2/C(=O)C3CCN2CC3 |
Computed by PubChem (NCBI)