CAS 1251004-19-9 appears in our catalog under these names: 3-Azabicyclo(3.2.0)heptane-3-carboxylic acid, 6-oxo-, 1,1-dimethylethyl ester, (1R,5S)-rel-, 97%, rac-tert-butyl (1R,5S)-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Tert-butyl (1R,5S)-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate (CAS 1251004-19-9) is a chemical compound with the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. IUPAC name: tert-butyl (1R,5S)-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate. InChIKey: SSFIFLZYPGAHGB-JGVFFNPUSA-N.
| Molecular formula | C11H17NO3 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | tert-butyl (1R,5S)-6-oxo-3-azabicyclo[3.2.0]heptane-3-carboxylate |
| InChIKey | SSFIFLZYPGAHGB-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC(=O)[C@@H]2C1 |
Computed by PubChem (NCBI)