Products 1283003-37-1

CAS 1283003-37-1 is the registry number for 3-[1-(Propylcarbamoyl)piperidin-4-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-[1-(propylcarbamoyl)piperidin-4-yl]propanoic acid (CAS 1283003-37-1) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: 3-[1-(propylcarbamoyl)piperidin-4-yl]propanoic acid. InChIKey: ZORCLZARFXAODQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O3
Molecular weight242.31 g/mol
IUPAC name3-[1-(propylcarbamoyl)piperidin-4-yl]propanoic acid
InChIKeyZORCLZARFXAODQ-UHFFFAOYSA-N
SMILESCCCNC(=O)N1CCC(CC1)CCC(=O)O

Computed by PubChem (NCBI)