Products 1251006-87-7
CAS 1251006-87-7 is the registry number for rel-(3S,3aR,6aS)-tert-Butyl 3-Aminohexahydro-1H-furo(3,4-b)pyrrole-1-carboxylate. Offered by: TRC. Available pack sizes: 75mg.
Tert-butyl (3R,3aS,6aR)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate (CAS 1251006-87-7) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl (3R,3aS,6aR)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate. InChIKey: DPIYNHZJLANOBC-CIUDSAMLSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl (3R,3aS,6aR)-3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-1-carboxylate |
| InChIKey | DPIYNHZJLANOBC-CIUDSAMLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H]2[C@@H]1COC2)N |
Computed by PubChem (NCBI)