Products 1251020-72-0
CAS 1251020-72-0 is the registry number for tert-Butyl 8-fluoro-2,6-diazaspiro[3.4]octane-6-carboxylate, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl 8-fluoro-2,6-diazaspiro[3.4]octane-6-carboxylate (CAS 1251020-72-0) is a chemical compound with the molecular formula C11H19FN2O2 and a molecular weight of 230.28 g/mol. IUPAC name: tert-butyl 8-fluoro-2,6-diazaspiro[3.4]octane-6-carboxylate. InChIKey: PDGVUHNUVHLXBB-UHFFFAOYSA-N.
| Molecular formula | C11H19FN2O2 |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | tert-butyl 8-fluoro-2,6-diazaspiro[3.4]octane-6-carboxylate |
| InChIKey | PDGVUHNUVHLXBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C2(C1)CNC2)F |
Computed by PubChem (NCBI)