Products 2782707-62-2
CAS 2782707-62-2 is the registry number for tert-Butyl (3aS,6aR)-3a-fluorohexahydropyrrolo[3,4-c]pyrrole-2(1H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (CAS 2782707-62-2) is a chemical compound with the molecular formula C11H19FN2O2 and a molecular weight of 230.28 g/mol. IUPAC name: tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate. InChIKey: XNJNGCHBGCIRKD-KCJUWKMLSA-N.
| Molecular formula | C11H19FN2O2 |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | tert-butyl (3aS,6aR)-3a-fluoro-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| InChIKey | XNJNGCHBGCIRKD-KCJUWKMLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CNC[C@@]2(C1)F |
Computed by PubChem (NCBI)