CAS 1257293-81-4 is the registry number for tert-Butyl 3-(3-fluoroazetidin-1-yl)azetidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
Tert-butyl 3-(3-fluoroazetidin-1-yl)azetidine-1-carboxylate (CAS 1257293-81-4) is a chemical compound with the molecular formula C11H19FN2O2 and a molecular weight of 230.28 g/mol. IUPAC name: tert-butyl 3-(3-fluoroazetidin-1-yl)azetidine-1-carboxylate. InChIKey: OHVJYJRGWBFBGR-UHFFFAOYSA-N.
| Molecular formula | C11H19FN2O2 |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | tert-butyl 3-(3-fluoroazetidin-1-yl)azetidine-1-carboxylate |
| InChIKey | OHVJYJRGWBFBGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)N2CC(C2)F |
Computed by PubChem (NCBI)