Products 1251020-98-0

CAS 1251020-98-0 is the registry number for 3-Oxo-1,8-dioxa-4,11-diaza-spiro[5.6]dodecane-11-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 3-oxo-1,11-dioxa-4,8-diazaspiro[5.6]dodecane-8-carboxylate (CAS 1251020-98-0) is a chemical compound with the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. IUPAC name: benzyl 3-oxo-1,11-dioxa-4,8-diazaspiro[5.6]dodecane-8-carboxylate. InChIKey: BKQHTVQPQIDGHU-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20N2O5
Molecular weight320.34 g/mol
IUPAC namebenzyl 3-oxo-1,11-dioxa-4,8-diazaspiro[5.6]dodecane-8-carboxylate
InChIKeyBKQHTVQPQIDGHU-UHFFFAOYSA-N
SMILESC1COCC2(CNC(=O)CO2)CN1C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)