CAS 21027-01-0 appears in our catalog under these names: Z-Ala-pro-oh, 95%, Z–Ala–Pro–OH, Z-Ala-Pro-OH, Z-Ala-Pro-OH, 98%, 98%, ((Benzyloxy)carbonyl)-L-alanyl-L-proline, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 50g, 100mg.
(2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid (CAS 21027-01-0) is a chemical compound with the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. IUPAC name: (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: RSSOZTMMMIWOJB-AAEUAGOBSA-N.
| Molecular formula | C16H20N2O5 |
|---|---|
| Molecular weight | 320.34 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | RSSOZTMMMIWOJB-AAEUAGOBSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)