Products 1264041-92-0
CAS 1264041-92-0 is the registry number for 3-(Ethoxycarbonyl)-1-(4-ethoxyphenyl)-5-methyl-4,5-dihydro-1H-pyrazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethoxycarbonyl-2-(4-ethoxyphenyl)-3-methyl-4H-pyrazole-3-carboxylic acid (CAS 1264041-92-0) is a chemical compound with the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. IUPAC name: 5-ethoxycarbonyl-2-(4-ethoxyphenyl)-3-methyl-4H-pyrazole-3-carboxylic acid. InChIKey: ISKJZXMOYMOPHX-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O5 |
|---|---|
| Molecular weight | 320.34 g/mol |
| IUPAC name | 5-ethoxycarbonyl-2-(4-ethoxyphenyl)-3-methyl-4H-pyrazole-3-carboxylic acid |
| InChIKey | ISKJZXMOYMOPHX-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C(CC(=N2)C(=O)OCC)(C)C(=O)O |
Computed by PubChem (NCBI)