CAS 1932559-29-9 is the registry number for (4As,8as)-tert-butyl hexahydro-1h-pyrido[3,4-b][1,4]oxazine-6(7h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
Tert-butyl (4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine-6-carboxylate (CAS 1932559-29-9) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: COJUSTWUQICURS-UWVGGRQHSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | COJUSTWUQICURS-UWVGGRQHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@H](C1)OCCN2 |
Computed by PubChem (NCBI)