CAS 1251074-61-9 is the registry number for 1-Benzyl-3-methyl-1H-1,2,4-triazol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzyl-5-methyl-1,2,4-triazol-3-amine (CAS 1251074-61-9) is a chemical compound with the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. IUPAC name: 2-benzyl-5-methyl-1,2,4-triazol-3-amine. InChIKey: PBHMKTXDYFEAAX-UHFFFAOYSA-N.
| Molecular formula | C10H12N4 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 2-benzyl-5-methyl-1,2,4-triazol-3-amine |
| InChIKey | PBHMKTXDYFEAAX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)