CAS 1251101-59-3 is the registry number for 3-Methyl-4-(1H-pyrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-methyl-4-pyrazol-1-ylbenzoic acid (CAS 1251101-59-3) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-methyl-4-pyrazol-1-ylbenzoic acid. InChIKey: BUQAHTXZCXPYMW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-methyl-4-pyrazol-1-ylbenzoic acid |
| InChIKey | BUQAHTXZCXPYMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)N2C=CC=N2 |
Computed by PubChem (NCBI)