CAS 1251156-75-8 appears in our catalog under these names: 6-Oxo-1-(propan-2-yl)-1,4,5,6-tetrahydropyridazine-3-carboxylic acid, 95%, 6-Oxo-1-(propan-2-yl)-1,4,5,6-tetrahydropyridazine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
6-oxo-1-propan-2-yl-4,5-dihydropyridazine-3-carboxylic acid (CAS 1251156-75-8) is a chemical compound with the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: 6-oxo-1-propan-2-yl-4,5-dihydropyridazine-3-carboxylic acid. InChIKey: YYZGIEMWPZXCFA-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O3 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 6-oxo-1-propan-2-yl-4,5-dihydropyridazine-3-carboxylic acid |
| InChIKey | YYZGIEMWPZXCFA-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)CCC(=N1)C(=O)O |
Computed by PubChem (NCBI)