CAS 1251162-64-7 is the registry number for tert-Butyl 7-(6-aminopyridin-3-yl)-2,3-dihydrobenzo[f][1,4]oxazepine-4(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-(6-amino-3-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CAS 1251162-64-7) is a chemical compound with the molecular formula C19H23N3O3 and a molecular weight of 341.4 g/mol. IUPAC name: tert-butyl 7-(6-amino-3-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate. InChIKey: KIELLBBAOSVQDD-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | tert-butyl 7-(6-amino-3-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| InChIKey | KIELLBBAOSVQDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2)C3=CN=C(C=C3)N |
Computed by PubChem (NCBI)