CAS 1403783-31-2 appears in our catalog under these names: Nexturastat A, Nexturastat A, 4-[[Butyl[(phenylamino)carbonyl]amino]methyl]-N-hydroxybenzamide, 98%, 98%, Nexturastat A, 98.28%, Nexturastat A, 98%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
4-[[butyl(phenylcarbamoyl)amino]methyl]-N-hydroxybenzamide (CAS 1403783-31-2) is a chemical compound with the molecular formula C19H23N3O3 and a molecular weight of 341.4 g/mol. IUPAC name: 4-[[butyl(phenylcarbamoyl)amino]methyl]-N-hydroxybenzamide. InChIKey: JZWXMCPARMXZQV-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 4-[[butyl(phenylcarbamoyl)amino]methyl]-N-hydroxybenzamide |
| InChIKey | JZWXMCPARMXZQV-UHFFFAOYSA-N |
| SMILES | CCCCN(CC1=CC=C(C=C1)C(=O)NO)C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)