CAS 249607-96-3 appears in our catalog under these names: 3-[(4,5-Dihydro-1h-imidazol-2-ylmethyl)(4-methylphenyl)amino]phenol, acetic acid, 95%, Phentolamine acetate/ 95%, 3-{[(4,5-dihydro-1H-imidazol-2-yl)methyl](4-methylphenyl)amino}phenol, acetic acid, Phentolamine (acetate). Offered by: Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10g, 5g, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
Acetic acid;3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol (CAS 249607-96-3) is a chemical compound with the molecular formula C19H23N3O3 and a molecular weight of 341.4 g/mol. IUPAC name: acetic acid;3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol. InChIKey: BKSNZPUAZBUONA-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O3 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | acetic acid;3-[N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-4-methylanilino]phenol |
| InChIKey | BKSNZPUAZBUONA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(CC2=NCCN2)C3=CC(=CC=C3)O.CC(=O)O |
Computed by PubChem (NCBI)