CAS 1251165-61-3 is the registry number for 5-(2,3,4,5-Tetrahydrobenzo[f][1,4]oxazepin-7-yl)pyridin-2-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)pyridin-2-amine;hydrochloride (CAS 1251165-61-3) is a chemical compound with the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. IUPAC name: 5-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)pyridin-2-amine;hydrochloride. InChIKey: VNDGTZPVAFLIHQ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O |
|---|---|
| Molecular weight | 277.75 g/mol |
| IUPAC name | 5-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)pyridin-2-amine;hydrochloride |
| InChIKey | VNDGTZPVAFLIHQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(CN1)C=C(C=C2)C3=CN=C(C=C3)N.Cl |
Computed by PubChem (NCBI)