CAS 459168-41-3 appears in our catalog under these names: JNJ7777120, JNJ-7777120/ 99.71% (existing batch purity), JNJ–7777120, JNJ-7777120 99%, (5-Chloro-1H-indol-2-yl)(4-methylpiperazin-1-yl)methanone, 99%, 99%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg, 500mg, 1mg, 250mg.
(5-chloro-1H-indol-2-yl)-(4-methylpiperazin-1-yl)methanone (CAS 459168-41-3) is a chemical compound with the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. IUPAC name: (5-chloro-1H-indol-2-yl)-(4-methylpiperazin-1-yl)methanone. InChIKey: HUQJRYMLJBBEDO-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O |
|---|---|
| Molecular weight | 277.75 g/mol |
| IUPAC name | (5-chloro-1H-indol-2-yl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | HUQJRYMLJBBEDO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)