Products 1285640-79-0
CAS 1285640-79-0 is the registry number for 2-(4-Acetyl-1,4-diazepan-1-yl)-4-chlorobenzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-acetyl-1,4-diazepan-1-yl)-4-chlorobenzonitrile (CAS 1285640-79-0) is a chemical compound with the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. IUPAC name: 2-(4-acetyl-1,4-diazepan-1-yl)-4-chlorobenzonitrile. InChIKey: MOVHDMDAZPSJOQ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O |
|---|---|
| Molecular weight | 277.75 g/mol |
| IUPAC name | 2-(4-acetyl-1,4-diazepan-1-yl)-4-chlorobenzonitrile |
| InChIKey | MOVHDMDAZPSJOQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCCN(CC1)C2=C(C=CC(=C2)Cl)C#N |
Computed by PubChem (NCBI)